C8H8N4O3 — CID 177214283
1,3-dimethyl-6H-pyrimido[4,5-d]pyrimidine-2,4,5-trione (PubChem CID 177214283) has the molecular formula C8H8N4O3 and a molecular weight of 208.18 g/mol. Its IUPAC name is 1,3-dimethyl-6H-pyrimido[4,5-d]pyrimidine-2,4,5-trione.
| Compound Name | 1,3-dimethyl-6H-pyrimido[4,5-d]pyrimidine-2,4,5-trione |
|---|---|
| PubChem CID | 177214283 |
| Molecular Formula | C8H8N4O3 |
| Molecular Weight | 208.18 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | 1,3-dimethyl-6H-pyrimido[4,5-d]pyrimidine-2,4,5-trione |
| SMILES | Cn1c(=O)c2c(=O)[nH]cnc2n(C)c1=O |
| InChI | InChI=1S/C8H8N4O3/c1-11-5-4(6(13)10-3-9-5)7(14)12(2)8(11)15/h3H,1-2H3,(H,9,10,13) |
| InChIKey | NOTHMBFPWQJKDV-UHFFFAOYSA-N |
| XLogP | -1.68 |
| TPSA | 89.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.18 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |