C36H34ClMnN7O4 — CID 177214696
CID 177214696 (PubChem CID 177214696) has the molecular formula C36H34ClMnN7O4 and a molecular weight of 719.10 g/mol.
| Compound Name | CID 177214696 |
|---|---|
| PubChem CID | 177214696 |
| Molecular Formula | C36H34ClMnN7O4 |
| Molecular Weight | 719.10 g/mol |
| Exact Mass | 718.17 |
| IUPAC Name | — |
| SMILES | COc1nc(-c2cccc(-c3cccc(Nc4nncc5c4c(=O)n(C)c(=O)n5C)c3C)c2Cl)cc2c1[C@@H](N1C[C-](CC[C-]=O)C1)CC2.[Mn+2] |
| InChI | InChI=1S/C36H34ClN7O4.Mn/c1-20-23(9-6-12-26(20)39-33-31-29(17-38-41-33)42(2)36(47)43(3)35(31)46)24-10-5-11-25(32(24)37)27-16-22-13-14-28(30(22)34(40-27)48-4)44-18-21(19-44)8-7-15-45;/h5-6,9-12,16-17,28H,7-8,13-14,18-19H2,1-4H3,(H,39,41);/q-2;+2/t28-;/m0./s1 |
| InChIKey | SAWMOOSNZOCEOL-JCOPYZAKSA-N |
| XLogP | 5.24 |
| TPSA | 124.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.10 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|