C37H31Cl2F3MnN6O4 — CID 177216315
CID 177216315 (PubChem CID 177216315) has the molecular formula C37H31Cl2F3MnN6O4 and a molecular weight of 806.53 g/mol.
| Compound Name | CID 177216315 |
|---|---|
| PubChem CID | 177216315 |
| Molecular Formula | C37H31Cl2F3MnN6O4 |
| Molecular Weight | 806.53 g/mol |
| Exact Mass | 805.11 |
| IUPAC Name | — |
| SMILES | COc1nc(-c2cccc(-c3cccc(Nc4nc(C(F)(F)F)cc5c4c(=O)n(C)c(=O)n5C)c3Cl)c2Cl)cc2c1[C@@H](N1C[C-](CC[C-]=O)C1)CC2.[Mn+2] |
| InChI | InChI=1S/C37H31Cl2F3N6O4.Mn/c1-46-27-16-28(37(40,41)42)45-33(30(27)35(50)47(2)36(46)51)43-24-11-5-9-22(32(24)39)21-8-4-10-23(31(21)38)25-15-20-12-13-26(29(20)34(44-25)52-3)48-17-19(18-48)7-6-14-49;/h4-5,8-11,15-16,26H,6-7,12-13,17-18H2,1-3H3,(H,43,45);/q-2;+2/t26-;/m0./s1 |
| InChIKey | LVKAKMXTOBJYNR-SNYZSRNZSA-N |
| XLogP | 7.20 |
| TPSA | 111.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.53 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|