C8H7N5O — CID 177218146
1-(1H-imidazo[4,5-c]pyridin-4-yl)-1,3-diazetidin-2-one (PubChem CID 177218146) has the molecular formula C8H7N5O and a molecular weight of 189.18 g/mol. Its IUPAC name is 1-(1H-imidazo[4,5-c]pyridin-4-yl)-1,3-diazetidin-2-one.
| Compound Name | 1-(1H-imidazo[4,5-c]pyridin-4-yl)-1,3-diazetidin-2-one |
|---|---|
| PubChem CID | 177218146 |
| Molecular Formula | C8H7N5O |
| Molecular Weight | 189.18 g/mol |
| Exact Mass | 189.07 |
| IUPAC Name | 1-(1H-imidazo[4,5-c]pyridin-4-yl)-1,3-diazetidin-2-one |
| SMILES | O=C1NCN1c1nccc2[nH]cnc12 |
| InChI | InChI=1S/C8H7N5O/c14-8-12-4-13(8)7-6-5(1-2-9-7)10-3-11-6/h1-3H,4H2,(H,10,11)(H,12,14) |
| InChIKey | PCCOBGFTFWTCKB-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.18 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |