C28H34N2OS — CID 177218555
N-[4-[2-(4,5-dihydro-3H-azepin-7-yl)-2-(2,3-dimethylphenyl)ethyl]phenyl]oxane-4-carbothioamide (PubChem CID 177218555) has the molecular formula C28H34N2OS and a molecular weight of 446.66 g/mol. Its IUPAC name is N-[4-[2-(4,5-dihydro-3H-azepin-7-yl)-2-(2,3-dimethylphenyl)ethyl]phenyl]oxane-4-carbothioamide.
| Compound Name | N-[4-[2-(4,5-dihydro-3H-azepin-7-yl)-2-(2,3-dimethylphenyl)ethyl]phenyl]oxane-4-carbothioamide |
|---|---|
| PubChem CID | 177218555 |
| Molecular Formula | C28H34N2OS |
| Molecular Weight | 446.66 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | N-[4-[2-(4,5-dihydro-3H-azepin-7-yl)-2-(2,3-dimethylphenyl)ethyl]phenyl]oxane-4-carbothioamide |
| SMILES | Cc1cccc(C(Cc2ccc(NC(=S)C3CCOCC3)cc2)C2=CCCCC=N2)c1C |
| InChI | InChI=1S/C28H34N2OS/c1-20-7-6-8-25(21(20)2)26(27-9-4-3-5-16-29-27)19-22-10-12-24(13-11-22)30-28(32)23-14-17-31-18-15-23/h6-13,16,23,26H,3-5,14-15,17-19H2,1-2H3,(H,30,32) |
| InChIKey | KTSZLXWOXBJOMS-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.66 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|