C25H29N3OS — CID 172505756
N-[4-[2-(2,3-dimethylphenyl)-2-(1H-imidazol-5-yl)ethyl]phenyl]oxane-4-carbothioamide (PubChem CID 172505756) has the molecular formula C25H29N3OS and a molecular weight of 419.59 g/mol. Its IUPAC name is N-[4-[2-(2,3-dimethylphenyl)-2-(1H-imidazol-5-yl)ethyl]phenyl]oxane-4-carbothioamide.
| Compound Name | N-[4-[2-(2,3-dimethylphenyl)-2-(1H-imidazol-5-yl)ethyl]phenyl]oxane-4-carbothioamide |
|---|---|
| PubChem CID | 172505756 |
| Molecular Formula | C25H29N3OS |
| Molecular Weight | 419.59 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | N-[4-[2-(2,3-dimethylphenyl)-2-(1H-imidazol-5-yl)ethyl]phenyl]oxane-4-carbothioamide |
| SMILES | Cc1cccc(C(Cc2ccc(NC(=S)C3CCOCC3)cc2)c2cnc[nH]2)c1C |
| InChI | InChI=1S/C25H29N3OS/c1-17-4-3-5-22(18(17)2)23(24-15-26-16-27-24)14-19-6-8-21(9-7-19)28-25(30)20-10-12-29-13-11-20/h3-9,15-16,20,23H,10-14H2,1-2H3,(H,26,27)(H,28,30) |
| InChIKey | AJTILJPGYPETDK-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.59 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|