C17H25N3O2 — CID 172505839
2-[2-[2-(2,3-dimethylphenyl)-2-(1H-imidazol-5-yl)ethoxy]ethoxy]ethanamine (PubChem CID 172505839) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 2-[2-[2-(2,3-dimethylphenyl)-2-(1H-imidazol-5-yl)ethoxy]ethoxy]ethanamine.
| Compound Name | 2-[2-[2-(2,3-dimethylphenyl)-2-(1H-imidazol-5-yl)ethoxy]ethoxy]ethanamine |
|---|---|
| PubChem CID | 172505839 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 2-[2-[2-(2,3-dimethylphenyl)-2-(1H-imidazol-5-yl)ethoxy]ethoxy]ethanamine |
| SMILES | Cc1cccc(C(COCCOCCN)c2cnc[nH]2)c1C |
| InChI | InChI=1S/C17H25N3O2/c1-13-4-3-5-15(14(13)2)16(17-10-19-12-20-17)11-22-9-8-21-7-6-18/h3-5,10,12,16H,6-9,11,18H2,1-2H3,(H,19,20) |
| InChIKey | DPKUYLAEAXBVFI-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|