C18H27N3O4S — CID 176559960
N-[2-[2-[2-(2,3-dimethylphenyl)-2-(1H-imidazol-5-yl)ethoxy]ethoxy]ethyl]methanesulfonamide (PubChem CID 176559960) has the molecular formula C18H27N3O4S and a molecular weight of 381.50 g/mol. Its IUPAC name is N-[2-[2-[2-(2,3-dimethylphenyl)-2-(1H-imidazol-5-yl)ethoxy]ethoxy]ethyl]methanesulfonamide.
| Compound Name | N-[2-[2-[2-(2,3-dimethylphenyl)-2-(1H-imidazol-5-yl)ethoxy]ethoxy]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 176559960 |
| Molecular Formula | C18H27N3O4S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | N-[2-[2-[2-(2,3-dimethylphenyl)-2-(1H-imidazol-5-yl)ethoxy]ethoxy]ethyl]methanesulfonamide |
| SMILES | Cc1cccc(C(COCCOCCNS(C)(=O)=O)c2cnc[nH]2)c1C |
| InChI | InChI=1S/C18H27N3O4S/c1-14-5-4-6-16(15(14)2)17(18-11-19-13-20-18)12-25-10-9-24-8-7-21-26(3,22)23/h4-6,11,13,17,21H,7-10,12H2,1-3H3,(H,19,20) |
| InChIKey | MDCOEHUQSGGIGB-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|