C17H25N3O4S — CID 172505571
N-[2-[2-[(2,3-dimethylphenyl)-(1H-imidazol-5-yl)methoxy]ethoxy]ethyl]methanesulfonamide (PubChem CID 172505571) has the molecular formula C17H25N3O4S and a molecular weight of 367.47 g/mol. Its IUPAC name is N-[2-[2-[(2,3-dimethylphenyl)-(1H-imidazol-5-yl)methoxy]ethoxy]ethyl]methanesulfonamide.
| Compound Name | N-[2-[2-[(2,3-dimethylphenyl)-(1H-imidazol-5-yl)methoxy]ethoxy]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 172505571 |
| Molecular Formula | C17H25N3O4S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | N-[2-[2-[(2,3-dimethylphenyl)-(1H-imidazol-5-yl)methoxy]ethoxy]ethyl]methanesulfonamide |
| SMILES | Cc1cccc(C(OCCOCCNS(C)(=O)=O)c2cnc[nH]2)c1C |
| InChI | InChI=1S/C17H25N3O4S/c1-13-5-4-6-15(14(13)2)17(16-11-18-12-19-16)24-10-9-23-8-7-20-25(3,21)22/h4-6,11-12,17,20H,7-10H2,1-3H3,(H,18,19) |
| InChIKey | PCOXTJIUXQJDKN-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|