C20H26N3OP — CID 176560130
3-[(2,3-dimethylphenyl)-(1H-imidazol-5-yl)methyl]aniline;methoxy(methyl)phosphane (PubChem CID 176560130) has the molecular formula C20H26N3OP and a molecular weight of 355.42 g/mol. Its IUPAC name is 3-[(2,3-dimethylphenyl)-(1H-imidazol-5-yl)methyl]aniline;methoxy(methyl)phosphane.
| Compound Name | 3-[(2,3-dimethylphenyl)-(1H-imidazol-5-yl)methyl]aniline;methoxy(methyl)phosphane |
|---|---|
| PubChem CID | 176560130 |
| Molecular Formula | C20H26N3OP |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 3-[(2,3-dimethylphenyl)-(1H-imidazol-5-yl)methyl]aniline;methoxy(methyl)phosphane |
| SMILES | COPC.Cc1cccc(C(c2cccc(N)c2)c2cnc[nH]2)c1C |
| InChI | InChI=1S/C18H19N3.C2H7OP/c1-12-5-3-8-16(13(12)2)18(17-10-20-11-21-17)14-6-4-7-15(19)9-14;1-3-4-2/h3-11,18H,19H2,1-2H3,(H,20,21);4H,1-2H3 |
| InChIKey | WXXOXCSCQASKNB-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|