C20H22N4O2 — CID 172505495
1-[3-[(2,3-dimethylphenyl)-(1H-imidazol-5-yl)methyl]phenyl]-3-methoxyurea (PubChem CID 172505495) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is 1-[3-[(2,3-dimethylphenyl)-(1H-imidazol-5-yl)methyl]phenyl]-3-methoxyurea.
| Compound Name | 1-[3-[(2,3-dimethylphenyl)-(1H-imidazol-5-yl)methyl]phenyl]-3-methoxyurea |
|---|---|
| PubChem CID | 172505495 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 1-[3-[(2,3-dimethylphenyl)-(1H-imidazol-5-yl)methyl]phenyl]-3-methoxyurea |
| SMILES | CONC(=O)Nc1cccc(C(c2cnc[nH]2)c2cccc(C)c2C)c1 |
| InChI | InChI=1S/C20H22N4O2/c1-13-6-4-9-17(14(13)2)19(18-11-21-12-22-18)15-7-5-8-16(10-15)23-20(25)24-26-3/h4-12,19H,1-3H3,(H,21,22)(H2,23,24,25) |
| InChIKey | INOPCMRBAJNZMR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|