About [3-[(2,3-dimethylphenyl)-(1H-imidazol-5-yl)methyl]phenyl]-morpholin-4-ylmethanone
[3-[(2,3-dimethylphenyl)-(1H-imidazol-5-yl)methyl]phenyl]-morpholin-4-ylmethanone (PubChem CID 172505823) has the molecular formula C23H25N3O2
and a molecular weight of 375.47 g/mol. Its IUPAC name is [3-[(2,3-dimethylphenyl)-(1H-imidazol-5-yl)methyl]phenyl]-morpholin-4-ylmethanone.
Molecular Properties
| Compound Name | [3-[(2,3-dimethylphenyl)-(1H-imidazol-5-yl)methyl]phenyl]-morpholin-4-ylmethanone |
| PubChem CID | 172505823 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | [3-[(2,3-dimethylphenyl)-(1H-imidazol-5-yl)methyl]phenyl]-morpholin-4-ylmethanone |
| SMILES | Cc1cccc(C(c2cccc(C(=O)N3CCOCC3)c2)c2cnc[nH]2)c1C |
| InChI | InChI=1S/C23H25N3O2/c1-16-5-3-8-20(17(16)2)22(21-14-24-15-25-21)18-6-4-7-19(13-18)23(27)26-9-11-28-12-10-26/h3-8,13-15,22H,9-12H2,1-2H3,(H,24,25) |
| InChIKey | PQXFLJHXXYDCLU-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-[(2,3-dimethylphenyl)-(1H-imidazol-5-yl)methyl]phenyl]-morpholin-4-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(2,3-dimethylphenyl)-(1H-imidazol-5-yl)methyl]phenyl]-morpholin-4-ylmethanone?
The IUPAC name of [3-[(2,3-dimethylphenyl)-(1H-imidazol-5-yl)methyl]phenyl]-morpholin-4-ylmethanone (CID 172505823) is [3-[(2,3-dimethylphenyl)-(1H-imidazol-5-yl)methyl]phenyl]-morpholin-4-ylmethanone.
What is the SMILES notation for [3-[(2,3-dimethylphenyl)-(1H-imidazol-5-yl)methyl]phenyl]-morpholin-4-ylmethanone?
The canonical SMILES for [3-[(2,3-dimethylphenyl)-(1H-imidazol-5-yl)methyl]phenyl]-morpholin-4-ylmethanone is Cc1cccc(C(c2cccc(C(=O)N3CCOCC3)c2)c2cnc[nH]2)c1C.
What is the InChIKey of [3-[(2,3-dimethylphenyl)-(1H-imidazol-5-yl)methyl]phenyl]-morpholin-4-ylmethanone?
The InChIKey is PQXFLJHXXYDCLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25N3O2/c1-16-5-3-8-20(17(16)2)22(21-14-24-15-25-21)18-6-4-7-19(13-18)23(27)26-9-11-28-12-10-26/h3-8,13-15,22H,9-12H2,1-2H3,(H,24,25).
What are the key properties of [3-[(2,3-dimethylphenyl)-(1H-imidazol-5-yl)methyl]phenyl]-morpholin-4-ylmethanone?
[3-[(2,3-dimethylphenyl)-(1H-imidazol-5-yl)methyl]phenyl]-morpholin-4-ylmethanone has a molecular weight of 375.47 g/mol, XLogP of 3.68, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(2,3-dimethylphenyl)-(1H-imidazol-5-yl)methyl]phenyl]-morpholin-4-ylmethanone is sourced from PubChem (CID 172505823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).