C24H27N3O3 — CID 172505752
N-[3-[1H-imidazol-5-yl-(2-methoxyphenyl)methyl]phenyl]-2-(oxan-4-yl)acetamide (PubChem CID 172505752) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is N-[3-[1H-imidazol-5-yl-(2-methoxyphenyl)methyl]phenyl]-2-(oxan-4-yl)acetamide.
| Compound Name | N-[3-[1H-imidazol-5-yl-(2-methoxyphenyl)methyl]phenyl]-2-(oxan-4-yl)acetamide |
|---|---|
| PubChem CID | 172505752 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | N-[3-[1H-imidazol-5-yl-(2-methoxyphenyl)methyl]phenyl]-2-(oxan-4-yl)acetamide |
| SMILES | COc1ccccc1C(c1cccc(NC(=O)CC2CCOCC2)c1)c1cnc[nH]1 |
| InChI | InChI=1S/C24H27N3O3/c1-29-22-8-3-2-7-20(22)24(21-15-25-16-26-21)18-5-4-6-19(14-18)27-23(28)13-17-9-11-30-12-10-17/h2-8,14-17,24H,9-13H2,1H3,(H,25,26)(H,27,28) |
| InChIKey | AJOSFPUOKBVOJG-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |