C21H23F3N2O5S — CID 169307783
N-[3-methoxy-4-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]-2-(oxan-4-yl)acetamide (PubChem CID 169307783) has the molecular formula C21H23F3N2O5S and a molecular weight of 472.49 g/mol. Its IUPAC name is N-[3-methoxy-4-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]-2-(oxan-4-yl)acetamide.
| Compound Name | N-[3-methoxy-4-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]-2-(oxan-4-yl)acetamide |
|---|---|
| PubChem CID | 169307783 |
| Molecular Formula | C21H23F3N2O5S |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | N-[3-methoxy-4-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]-2-(oxan-4-yl)acetamide |
| SMILES | COc1cc(NC(=O)CC2CCOCC2)ccc1S(=O)(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H23F3N2O5S/c1-30-18-13-16(25-20(27)11-14-7-9-31-10-8-14)5-6-19(18)32(28,29)26-17-4-2-3-15(12-17)21(22,23)24/h2-6,12-14,26H,7-11H2,1H3,(H,25,27) |
| InChIKey | DUZTWFYUVQSQBY-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |