C21H29N2O4P3S — CID 170338932
2-cyclopentyl-N-[3-methoxy-4-[[3-[tris(phosphanyl)methyl]phenyl]sulfamoyl]phenyl]acetamide (PubChem CID 170338932) has the molecular formula C21H29N2O4P3S and a molecular weight of 498.46 g/mol. Its IUPAC name is 2-cyclopentyl-N-[3-methoxy-4-[[3-[tris(phosphanyl)methyl]phenyl]sulfamoyl]phenyl]acetamide.
| Compound Name | 2-cyclopentyl-N-[3-methoxy-4-[[3-[tris(phosphanyl)methyl]phenyl]sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 170338932 |
| Molecular Formula | C21H29N2O4P3S |
| Molecular Weight | 498.46 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | 2-cyclopentyl-N-[3-methoxy-4-[[3-[tris(phosphanyl)methyl]phenyl]sulfamoyl]phenyl]acetamide |
| SMILES | COc1cc(NC(=O)CC2CCCC2)ccc1S(=O)(=O)Nc1cccc(C(P)(P)P)c1 |
| InChI | InChI=1S/C21H29N2O4P3S/c1-27-18-13-16(22-20(24)11-14-5-2-3-6-14)9-10-19(18)31(25,26)23-17-8-4-7-15(12-17)21(28,29)30/h4,7-10,12-14,23H,2-3,5-6,11,28-30H2,1H3,(H,22,24) |
| InChIKey | MDAUNJABIQLXLB-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.46 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|