C19H18F3N3O4S — CID 169307860
(2S)-N-[3-methoxy-4-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]-2,5-dihydro-1H-pyrrole-2-carboxamide (PubChem CID 169307860) has the molecular formula C19H18F3N3O4S and a molecular weight of 441.43 g/mol. Its IUPAC name is (2S)-N-[3-methoxy-4-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]-2,5-dihydro-1H-pyrrole-2-carboxamide.
| Compound Name | (2S)-N-[3-methoxy-4-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]-2,5-dihydro-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 169307860 |
| Molecular Formula | C19H18F3N3O4S |
| Molecular Weight | 441.43 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | (2S)-N-[3-methoxy-4-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]-2,5-dihydro-1H-pyrrole-2-carboxamide |
| SMILES | COc1cc(NC(=O)[C@@H]2C=CCN2)ccc1S(=O)(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H18F3N3O4S/c1-29-16-11-13(24-18(26)15-6-3-9-23-15)7-8-17(16)30(27,28)25-14-5-2-4-12(10-14)19(20,21)22/h2-8,10-11,15,23,25H,9H2,1H3,(H,24,26)/t15-/m0/s1 |
| InChIKey | XYQQRTCJNDOVKF-HNNXBMFYSA-N |
| XLogP | 2.98 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.43 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|