About (Z)-2-(butylideneamino)-1-(3-fluorophenyl)but-2-en-1-one;carbanide;palladium
(Z)-2-(butylideneamino)-1-(3-fluorophenyl)but-2-en-1-one;carbanide;palladium (PubChem CID 177218668) has the molecular formula C15H19FNOPd-
and a molecular weight of 354.74 g/mol. Its IUPAC name is (Z)-2-(butylideneamino)-1-(3-fluorophenyl)but-2-en-1-one;carbanide;palladium.
Molecular Properties
| Compound Name | (Z)-2-(butylideneamino)-1-(3-fluorophenyl)but-2-en-1-one;carbanide;palladium |
| PubChem CID | 177218668 |
| Molecular Formula | C15H19FNOPd- |
| Molecular Weight | 354.74 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | (Z)-2-(butylideneamino)-1-(3-fluorophenyl)but-2-en-1-one;carbanide;palladium |
| SMILES | C/C=C(\N=C\CCC)C(=O)c1cccc(F)c1.[CH3-].[Pd] |
| InChI | InChI=1S/C14H16FNO.CH3.Pd/c1-3-5-9-16-13(4-2)14(17)11-7-6-8-12(15)10-11;;/h4,6-10H,3,5H2,1-2H3;1H3;/q;-1;/b13-4-,16-9+;; |
| InChIKey | DUPKQENGFYOVAC-XHQZNZAVSA-N |
| XLogP | 4.23 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.74 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-(butylideneamino)-1-(3-fluorophenyl)but-2-en-1-one;carbanide;palladium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-(butylideneamino)-1-(3-fluorophenyl)but-2-en-1-one;carbanide;palladium?
The IUPAC name of (Z)-2-(butylideneamino)-1-(3-fluorophenyl)but-2-en-1-one;carbanide;palladium (CID 177218668) is (Z)-2-(butylideneamino)-1-(3-fluorophenyl)but-2-en-1-one;carbanide;palladium.
What is the SMILES notation for (Z)-2-(butylideneamino)-1-(3-fluorophenyl)but-2-en-1-one;carbanide;palladium?
The canonical SMILES for (Z)-2-(butylideneamino)-1-(3-fluorophenyl)but-2-en-1-one;carbanide;palladium is C/C=C(\N=C\CCC)C(=O)c1cccc(F)c1.[CH3-].[Pd].
What is the InChIKey of (Z)-2-(butylideneamino)-1-(3-fluorophenyl)but-2-en-1-one;carbanide;palladium?
The InChIKey is DUPKQENGFYOVAC-XHQZNZAVSA-N. The full InChI is InChI=1S/C14H16FNO.CH3.Pd/c1-3-5-9-16-13(4-2)14(17)11-7-6-8-12(15)10-11;;/h4,6-10H,3,5H2,1-2H3;1H3;/q;-1;/b13-4-,16-9+;;.
What are the key properties of (Z)-2-(butylideneamino)-1-(3-fluorophenyl)but-2-en-1-one;carbanide;palladium?
(Z)-2-(butylideneamino)-1-(3-fluorophenyl)but-2-en-1-one;carbanide;palladium has a molecular weight of 354.74 g/mol, XLogP of 4.23, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-(butylideneamino)-1-(3-fluorophenyl)but-2-en-1-one;carbanide;palladium is sourced from PubChem (CID 177218668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).