C15H11ClN4O2 — CID 177220531
4-[(5-chloro-2-pyridinyl)methyl]-2-methyl-3-oxopyrido[2,3-b]pyrazine-7-carbaldehyde (PubChem CID 177220531) has the molecular formula C15H11ClN4O2 and a molecular weight of 314.73 g/mol. Its IUPAC name is 4-[(5-chloro-2-pyridinyl)methyl]-2-methyl-3-oxopyrido[2,3-b]pyrazine-7-carbaldehyde.
| Compound Name | 4-[(5-chloro-2-pyridinyl)methyl]-2-methyl-3-oxopyrido[2,3-b]pyrazine-7-carbaldehyde |
|---|---|
| PubChem CID | 177220531 |
| Molecular Formula | C15H11ClN4O2 |
| Molecular Weight | 314.73 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 4-[(5-chloro-2-pyridinyl)methyl]-2-methyl-3-oxopyrido[2,3-b]pyrazine-7-carbaldehyde |
| SMILES | Cc1nc2cc(C=O)cnc2n(Cc2ccc(Cl)cn2)c1=O |
| InChI | InChI=1S/C15H11ClN4O2/c1-9-15(22)20(7-12-3-2-11(16)6-17-12)14-13(19-9)4-10(8-21)5-18-14/h2-6,8H,7H2,1H3 |
| InChIKey | BGZSCEFHQFLOBS-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 77.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.73 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|