C13H8ClN3O — CID 156810814
1-(5-chloro-3-pyridinyl)pyrrolo[2,3-b]pyridine-5-carbaldehyde (PubChem CID 156810814) has the molecular formula C13H8ClN3O and a molecular weight of 257.68 g/mol. Its IUPAC name is 1-(5-chloro-3-pyridinyl)pyrrolo[2,3-b]pyridine-5-carbaldehyde.
| Compound Name | 1-(5-chloro-3-pyridinyl)pyrrolo[2,3-b]pyridine-5-carbaldehyde |
|---|---|
| PubChem CID | 156810814 |
| Molecular Formula | C13H8ClN3O |
| Molecular Weight | 257.68 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | 1-(5-chloro-3-pyridinyl)pyrrolo[2,3-b]pyridine-5-carbaldehyde |
| SMILES | O=Cc1cnc2c(ccn2-c2cncc(Cl)c2)c1 |
| InChI | InChI=1S/C13H8ClN3O/c14-11-4-12(7-15-6-11)17-2-1-10-3-9(8-18)5-16-13(10)17/h1-8H |
| InChIKey | USMUTGBIUVOAOB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.68 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|