C15H9N3O2 — CID 163260904
4-(5-formylpyrrolo[2,3-b]pyridin-1-yl)-2-hydroxybenzonitrile (PubChem CID 163260904) has the molecular formula C15H9N3O2 and a molecular weight of 263.26 g/mol. Its IUPAC name is 4-(5-formylpyrrolo[2,3-b]pyridin-1-yl)-2-hydroxybenzonitrile.
| Compound Name | 4-(5-formylpyrrolo[2,3-b]pyridin-1-yl)-2-hydroxybenzonitrile |
|---|---|
| PubChem CID | 163260904 |
| Molecular Formula | C15H9N3O2 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 4-(5-formylpyrrolo[2,3-b]pyridin-1-yl)-2-hydroxybenzonitrile |
| SMILES | N#Cc1ccc(-n2ccc3cc(C=O)cnc32)cc1O |
| InChI | InChI=1S/C15H9N3O2/c16-7-12-1-2-13(6-14(12)20)18-4-3-11-5-10(9-19)8-17-15(11)18/h1-6,8-9,20H |
| InChIKey | ZPGGRYLUFLYGEP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|