C21H21F2N3O3 — CID 163260880
1-(2,2-difluoro-1,3-benzodioxol-5-yl)pyrrolo[2,3-b]pyridine-5-carbaldehyde;1-methylpiperidine (PubChem CID 163260880) has the molecular formula C21H21F2N3O3 and a molecular weight of 401.41 g/mol. Its IUPAC name is 1-(2,2-difluoro-1,3-benzodioxol-5-yl)pyrrolo[2,3-b]pyridine-5-carbaldehyde;1-methylpiperidine.
| Compound Name | 1-(2,2-difluoro-1,3-benzodioxol-5-yl)pyrrolo[2,3-b]pyridine-5-carbaldehyde;1-methylpiperidine |
|---|---|
| PubChem CID | 163260880 |
| Molecular Formula | C21H21F2N3O3 |
| Molecular Weight | 401.41 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 1-(2,2-difluoro-1,3-benzodioxol-5-yl)pyrrolo[2,3-b]pyridine-5-carbaldehyde;1-methylpiperidine |
| SMILES | CN1CCCCC1.O=Cc1cnc2c(ccn2-c2ccc3c(c2)OC(F)(F)O3)c1 |
| InChI | InChI=1S/C15H8F2N2O3.C6H13N/c16-15(17)21-12-2-1-11(6-13(12)22-15)19-4-3-10-5-9(8-20)7-18-14(10)19;1-7-5-3-2-4-6-7/h1-8H;2-6H2,1H3 |
| InChIKey | HNYAUOFKGAAFCS-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.41 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|