C22H26F2N4O3 — CID 176661233
4,4-difluoro-1-methylpiperidine;ethane;6-(5-formylpyrrolo[2,3-b]pyridin-1-yl)pyridine-3-carboxylic acid (PubChem CID 176661233) has the molecular formula C22H26F2N4O3 and a molecular weight of 432.47 g/mol. Its IUPAC name is 4,4-difluoro-1-methylpiperidine;ethane;6-(5-formylpyrrolo[2,3-b]pyridin-1-yl)pyridine-3-carboxylic acid.
| Compound Name | 4,4-difluoro-1-methylpiperidine;ethane;6-(5-formylpyrrolo[2,3-b]pyridin-1-yl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 176661233 |
| Molecular Formula | C22H26F2N4O3 |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | 4,4-difluoro-1-methylpiperidine;ethane;6-(5-formylpyrrolo[2,3-b]pyridin-1-yl)pyridine-3-carboxylic acid |
| SMILES | CC.CN1CCC(F)(F)CC1.O=Cc1cnc2c(ccn2-c2ccc(C(=O)O)cn2)c1 |
| InChI | InChI=1S/C14H9N3O3.C6H11F2N.C2H6/c18-8-9-5-10-3-4-17(13(10)16-6-9)12-2-1-11(7-15-12)14(19)20;1-9-4-2-6(7,8)3-5-9;1-2/h1-8H,(H,19,20);2-5H2,1H3;1-2H3 |
| InChIKey | AAKARCPIVLFCQY-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|