C21H20F2N4S — CID 163261140
4,4-difluoro-1-methylpiperidine;4-(5-methanethioylpyrrolo[2,3-b]pyridin-1-yl)benzonitrile (PubChem CID 163261140) has the molecular formula C21H20F2N4S and a molecular weight of 398.48 g/mol. Its IUPAC name is 4,4-difluoro-1-methylpiperidine;4-(5-methanethioylpyrrolo[2,3-b]pyridin-1-yl)benzonitrile.
| Compound Name | 4,4-difluoro-1-methylpiperidine;4-(5-methanethioylpyrrolo[2,3-b]pyridin-1-yl)benzonitrile |
|---|---|
| PubChem CID | 163261140 |
| Molecular Formula | C21H20F2N4S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 4,4-difluoro-1-methylpiperidine;4-(5-methanethioylpyrrolo[2,3-b]pyridin-1-yl)benzonitrile |
| SMILES | CN1CCC(F)(F)CC1.N#Cc1ccc(-n2ccc3cc(C=S)cnc32)cc1 |
| InChI | InChI=1S/C15H9N3S.C6H11F2N/c16-8-11-1-3-14(4-2-11)18-6-5-13-7-12(10-19)9-17-15(13)18;1-9-4-2-6(7,8)3-5-9/h1-7,9-10H;2-5H2,1H3 |
| InChIKey | YCCSIHTVXXLFHZ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 44.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|