C27H29F2N5O2 — CID 177185571
4,4-difluoro-1-methylpiperidine;4-[6-formyl-2-(5-hydroxy-5-methylhex-1-ynyl)imidazo[4,5-b]pyridin-3-yl]benzonitrile (PubChem CID 177185571) has the molecular formula C27H29F2N5O2 and a molecular weight of 493.56 g/mol. Its IUPAC name is 4,4-difluoro-1-methylpiperidine;4-[6-formyl-2-(5-hydroxy-5-methylhex-1-ynyl)imidazo[4,5-b]pyridin-3-yl]benzonitrile.
| Compound Name | 4,4-difluoro-1-methylpiperidine;4-[6-formyl-2-(5-hydroxy-5-methylhex-1-ynyl)imidazo[4,5-b]pyridin-3-yl]benzonitrile |
|---|---|
| PubChem CID | 177185571 |
| Molecular Formula | C27H29F2N5O2 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | 4,4-difluoro-1-methylpiperidine;4-[6-formyl-2-(5-hydroxy-5-methylhex-1-ynyl)imidazo[4,5-b]pyridin-3-yl]benzonitrile |
| SMILES | CC(C)(O)CCC#Cc1nc2cc(C=O)cnc2n1-c1ccc(C#N)cc1.CN1CCC(F)(F)CC1 |
| InChI | InChI=1S/C21H18N4O2.C6H11F2N/c1-21(2,27)10-4-3-5-19-24-18-11-16(14-26)13-23-20(18)25(19)17-8-6-15(12-22)7-9-17;1-9-4-2-6(7,8)3-5-9/h6-9,11,13-14,27H,4,10H2,1-2H3;2-5H2,1H3 |
| InChIKey | WXFMLIBRRKUYCC-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 95.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|