C18H14N4O2 — CID 176661301
3-[1-(4-cyanophenyl)-5-formylpyrrolo[2,3-b]pyridin-2-yl]propanamide (PubChem CID 176661301) has the molecular formula C18H14N4O2 and a molecular weight of 318.34 g/mol. Its IUPAC name is 3-[1-(4-cyanophenyl)-5-formylpyrrolo[2,3-b]pyridin-2-yl]propanamide.
| Compound Name | 3-[1-(4-cyanophenyl)-5-formylpyrrolo[2,3-b]pyridin-2-yl]propanamide |
|---|---|
| PubChem CID | 176661301 |
| Molecular Formula | C18H14N4O2 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 3-[1-(4-cyanophenyl)-5-formylpyrrolo[2,3-b]pyridin-2-yl]propanamide |
| SMILES | N#Cc1ccc(-n2c(CCC(N)=O)cc3cc(C=O)cnc32)cc1 |
| InChI | InChI=1S/C18H14N4O2/c19-9-12-1-3-15(4-2-12)22-16(5-6-17(20)24)8-14-7-13(11-23)10-21-18(14)22/h1-4,7-8,10-11H,5-6H2,(H2,20,24) |
| InChIKey | GKMJKCBJGALKGN-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 101.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|