C16H14N4O2 — CID 156811131
N-ethyl-6-(5-formylpyrrolo[2,3-b]pyridin-1-yl)pyridine-3-carboxamide (PubChem CID 156811131) has the molecular formula C16H14N4O2 and a molecular weight of 294.31 g/mol. Its IUPAC name is N-ethyl-6-(5-formylpyrrolo[2,3-b]pyridin-1-yl)pyridine-3-carboxamide.
| Compound Name | N-ethyl-6-(5-formylpyrrolo[2,3-b]pyridin-1-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 156811131 |
| Molecular Formula | C16H14N4O2 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | N-ethyl-6-(5-formylpyrrolo[2,3-b]pyridin-1-yl)pyridine-3-carboxamide |
| SMILES | CCNC(=O)c1ccc(-n2ccc3cc(C=O)cnc32)nc1 |
| InChI | InChI=1S/C16H14N4O2/c1-2-17-16(22)13-3-4-14(18-9-13)20-6-5-12-7-11(10-21)8-19-15(12)20/h3-10H,2H2,1H3,(H,17,22) |
| InChIKey | IFRNNKKJCBCATG-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|