C15H19N3O3 — CID 177221814
methyl N-[2-(5-methoxy-1-methylpyrazol-4-yl)-2-phenylethyl]carbamate (PubChem CID 177221814) has the molecular formula C15H19N3O3 and a molecular weight of 289.34 g/mol. Its IUPAC name is methyl N-[2-(5-methoxy-1-methylpyrazol-4-yl)-2-phenylethyl]carbamate.
| Compound Name | methyl N-[2-(5-methoxy-1-methylpyrazol-4-yl)-2-phenylethyl]carbamate |
|---|---|
| PubChem CID | 177221814 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | methyl N-[2-(5-methoxy-1-methylpyrazol-4-yl)-2-phenylethyl]carbamate |
| SMILES | COC(=O)NCC(c1ccccc1)c1cnn(C)c1OC |
| InChI | InChI=1S/C15H19N3O3/c1-18-14(20-2)13(10-17-18)12(9-16-15(19)21-3)11-7-5-4-6-8-11/h4-8,10,12H,9H2,1-3H3,(H,16,19) |
| InChIKey | ZPVGNISNVZZECP-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |