C11H18F3N — CID 177223408
2,2,6,6-tetramethyl-1-(1,2,2-trifluoroethenyl)piperidine (PubChem CID 177223408) has the molecular formula C11H18F3N and a molecular weight of 221.27 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-1-(1,2,2-trifluoroethenyl)piperidine.
| Compound Name | 2,2,6,6-tetramethyl-1-(1,2,2-trifluoroethenyl)piperidine |
|---|---|
| PubChem CID | 177223408 |
| Molecular Formula | C11H18F3N |
| Molecular Weight | 221.27 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 2,2,6,6-tetramethyl-1-(1,2,2-trifluoroethenyl)piperidine |
| SMILES | CC1(C)CCCC(C)(C)N1C(F)=C(F)F |
| InChI | InChI=1S/C11H18F3N/c1-10(2)6-5-7-11(3,4)15(10)9(14)8(12)13/h5-7H2,1-4H3 |
| InChIKey | BDSXBZPHLSIXAZ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.27 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|