C9H12F7N — CID 100952954
(2S,6R)-1-fluoro-2,6-dimethyl-2,6-bis(trifluoromethyl)piperidine (PubChem CID 100952954) has the molecular formula C9H12F7N and a molecular weight of 267.19 g/mol. Its IUPAC name is (2S,6R)-1-fluoro-2,6-dimethyl-2,6-bis(trifluoromethyl)piperidine.
| Compound Name | (2S,6R)-1-fluoro-2,6-dimethyl-2,6-bis(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 100952954 |
| Molecular Formula | C9H12F7N |
| Molecular Weight | 267.19 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | (2S,6R)-1-fluoro-2,6-dimethyl-2,6-bis(trifluoromethyl)piperidine |
| SMILES | C[C@]1(C(F)(F)F)CCC[C@@](C)(C(F)(F)F)N1F |
| InChI | InChI=1S/C9H12F7N/c1-6(8(10,11)12)4-3-5-7(2,17(6)16)9(13,14)15/h3-5H2,1-2H3/t6-,7+ |
| InChIKey | TUHOYOQSJNTWCI-KNVOCYPGSA-N |
| XLogP | 4.00 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.19 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|