C9H13F6N — CID 100952952
(2R,6S)-2,6-dimethyl-2,6-bis(trifluoromethyl)piperidine (PubChem CID 100952952) has the molecular formula C9H13F6N and a molecular weight of 249.20 g/mol. Its IUPAC name is (2R,6S)-2,6-dimethyl-2,6-bis(trifluoromethyl)piperidine.
| Compound Name | (2R,6S)-2,6-dimethyl-2,6-bis(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 100952952 |
| Molecular Formula | C9H13F6N |
| Molecular Weight | 249.20 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | (2R,6S)-2,6-dimethyl-2,6-bis(trifluoromethyl)piperidine |
| SMILES | C[C@]1(C(F)(F)F)CCC[C@@](C)(C(F)(F)F)N1 |
| InChI | InChI=1S/C9H13F6N/c1-6(8(10,11)12)4-3-5-7(2,16-6)9(13,14)15/h16H,3-5H2,1-2H3/t6-,7+ |
| InChIKey | VNQPQEXYGRHEOG-KNVOCYPGSA-N |
| XLogP | 3.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.20 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |