C9H18FN — CID 175086193
(3R)-3-fluoro-2,2,6,6-tetramethylpiperidine (PubChem CID 175086193) has the molecular formula C9H18FN and a molecular weight of 159.25 g/mol. Its IUPAC name is (3R)-3-fluoro-2,2,6,6-tetramethylpiperidine.
| Compound Name | (3R)-3-fluoro-2,2,6,6-tetramethylpiperidine |
|---|---|
| PubChem CID | 175086193 |
| Molecular Formula | C9H18FN |
| Molecular Weight | 159.25 g/mol |
| Exact Mass | 159.14 |
| IUPAC Name | (3R)-3-fluoro-2,2,6,6-tetramethylpiperidine |
| SMILES | CC1(C)CC[C@@H](F)C(C)(C)N1 |
| InChI | InChI=1S/C9H18FN/c1-8(2)6-5-7(10)9(3,4)11-8/h7,11H,5-6H2,1-4H3/t7-/m1/s1 |
| InChIKey | WCXVEQHJRSGQJK-SSDOTTSWSA-N |
| XLogP | 2.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.25 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |