C7H16N2 — CID 164879253
N,5,5-trimethylpyrrolidin-2-amine (PubChem CID 164879253) has the molecular formula C7H16N2 and a molecular weight of 128.22 g/mol. Its IUPAC name is N,5,5-trimethylpyrrolidin-2-amine.
| Compound Name | N,5,5-trimethylpyrrolidin-2-amine |
|---|---|
| PubChem CID | 164879253 |
| Molecular Formula | C7H16N2 |
| Molecular Weight | 128.22 g/mol |
| Exact Mass | 128.13 |
| IUPAC Name | N,5,5-trimethylpyrrolidin-2-amine |
| SMILES | CNC1CCC(C)(C)N1 |
| InChI | InChI=1S/C7H16N2/c1-7(2)5-4-6(8-3)9-7/h6,8-9H,4-5H2,1-3H3 |
| InChIKey | OOSQBWQXWZWEIB-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.22 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |