C8H18N2 — CID 145309299
N,4,4-trimethylpiperidin-2-amine (PubChem CID 145309299) has the molecular formula C8H18N2 and a molecular weight of 142.25 g/mol. Its IUPAC name is N,4,4-trimethylpiperidin-2-amine.
| Compound Name | N,4,4-trimethylpiperidin-2-amine |
|---|---|
| PubChem CID | 145309299 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | N,4,4-trimethylpiperidin-2-amine |
| SMILES | CNC1CC(C)(C)CCN1 |
| InChI | InChI=1S/C8H18N2/c1-8(2)4-5-10-7(6-8)9-3/h7,9-10H,4-6H2,1-3H3 |
| InChIKey | FITHBINHDYUBJJ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |