C9H18N2S — CID 142608904
7-methyl-2,3,3a,4,5,6,8,8a-octahydro-1H-pyrrolo[3,2-b]azepine-7-thiol (PubChem CID 142608904) has the molecular formula C9H18N2S and a molecular weight of 186.32 g/mol. Its IUPAC name is 7-methyl-2,3,3a,4,5,6,8,8a-octahydro-1H-pyrrolo[3,2-b]azepine-7-thiol.
| Compound Name | 7-methyl-2,3,3a,4,5,6,8,8a-octahydro-1H-pyrrolo[3,2-b]azepine-7-thiol |
|---|---|
| PubChem CID | 142608904 |
| Molecular Formula | C9H18N2S |
| Molecular Weight | 186.32 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 7-methyl-2,3,3a,4,5,6,8,8a-octahydro-1H-pyrrolo[3,2-b]azepine-7-thiol |
| SMILES | CC1(S)CCNC2CCNC2C1 |
| InChI | InChI=1S/C9H18N2S/c1-9(12)3-5-11-7-2-4-10-8(7)6-9/h7-8,10-12H,2-6H2,1H3 |
| InChIKey | UGUDEFOBIGMPJZ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.32 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|