C12H23N3S — CID 167288233
1,3,5-trimethyl-2-methylimino-3a,4,6,7,8,8a-hexahydrocyclohepta[d]imidazole-5-thiol (PubChem CID 167288233) has the molecular formula C12H23N3S and a molecular weight of 241.40 g/mol. Its IUPAC name is 1,3,5-trimethyl-2-methylimino-3a,4,6,7,8,8a-hexahydrocyclohepta[d]imidazole-5-thiol.
| Compound Name | 1,3,5-trimethyl-2-methylimino-3a,4,6,7,8,8a-hexahydrocyclohepta[d]imidazole-5-thiol |
|---|---|
| PubChem CID | 167288233 |
| Molecular Formula | C12H23N3S |
| Molecular Weight | 241.40 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 1,3,5-trimethyl-2-methylimino-3a,4,6,7,8,8a-hexahydrocyclohepta[d]imidazole-5-thiol |
| SMILES | C/N=C1\N(C)C2CCCC(C)(S)CC2N1C |
| InChI | InChI=1S/C12H23N3S/c1-12(16)7-5-6-9-10(8-12)15(4)11(13-2)14(9)3/h9-10,16H,5-8H2,1-4H3/b13-11+ |
| InChIKey | DGIYUXAOUFMCMQ-ACCUITESSA-N |
| XLogP | 1.85 |
| TPSA | 18.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.40 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|