C9H21N3 — CID 162358230
ethane;N,1,3-trimethyl-1,3-diazinan-2-imine (PubChem CID 162358230) has the molecular formula C9H21N3 and a molecular weight of 171.29 g/mol. Its IUPAC name is ethane;N,1,3-trimethyl-1,3-diazinan-2-imine.
| Compound Name | ethane;N,1,3-trimethyl-1,3-diazinan-2-imine |
|---|---|
| PubChem CID | 162358230 |
| Molecular Formula | C9H21N3 |
| Molecular Weight | 171.29 g/mol |
| Exact Mass | 171.17 |
| IUPAC Name | ethane;N,1,3-trimethyl-1,3-diazinan-2-imine |
| SMILES | CC.CN=C1N(C)CCCN1C |
| InChI | InChI=1S/C7H15N3.C2H6/c1-8-7-9(2)5-4-6-10(7)3;1-2/h4-6H2,1-3H3;1-2H3 |
| InChIKey | ZCYXMFMCLSDPAI-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.29 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|