C14H32N2 — CID 155752075
ethane;N,1,4,4-tetramethylazepan-2-imine (PubChem CID 155752075) has the molecular formula C14H32N2 and a molecular weight of 228.42 g/mol. Its IUPAC name is ethane;N,1,4,4-tetramethylazepan-2-imine.
| Compound Name | ethane;N,1,4,4-tetramethylazepan-2-imine |
|---|---|
| PubChem CID | 155752075 |
| Molecular Formula | C14H32N2 |
| Molecular Weight | 228.42 g/mol |
| Exact Mass | 228.26 |
| IUPAC Name | ethane;N,1,4,4-tetramethylazepan-2-imine |
| SMILES | C/N=C1\CC(C)(C)CCCN1C.CC.CC |
| InChI | InChI=1S/C10H20N2.2C2H6/c1-10(2)6-5-7-12(4)9(8-10)11-3;2*1-2/h5-8H2,1-4H3;2*1-2H3/b11-9+;; |
| InChIKey | OCATWBHTTTZBEW-OTBYXNOXSA-N |
| XLogP | 4.21 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.42 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|