About CID 155739723
CID 155739723 (PubChem CID 155739723) has the molecular formula C11H19BN2
and a molecular weight of 190.10 g/mol.
Molecular Properties
| Compound Name | CID 155739723 |
| PubChem CID | 155739723 |
| Molecular Formula | C11H19BN2 |
| Molecular Weight | 190.10 g/mol |
| Exact Mass | 190.16 |
| IUPAC Name | — |
| SMILES | [B]C1(C)CCCC2C(C1)N=C(C)N2C |
| InChI | InChI=1S/C11H19BN2/c1-8-13-9-7-11(2,12)6-4-5-10(9)14(8)3/h9-10H,4-7H2,1-3H3 |
| InChIKey | NJRUAFUVRHQNDF-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.10 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 155739723 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155739723?
The IUPAC name of CID 155739723 (CID 155739723) is not available.
What is the SMILES notation for CID 155739723?
The canonical SMILES for CID 155739723 is [B]C1(C)CCCC2C(C1)N=C(C)N2C.
What is the InChIKey of CID 155739723?
The InChIKey is NJRUAFUVRHQNDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19BN2/c1-8-13-9-7-11(2,12)6-4-5-10(9)14(8)3/h9-10H,4-7H2,1-3H3.
What are the key properties of CID 155739723?
CID 155739723 has a molecular weight of 190.10 g/mol, XLogP of 2.01, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155739723 is sourced from PubChem (CID 155739723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).