C11H19N — CID 57066590
2,10-dimethyl-10-azatricyclo[5.2.1.02,6]decane (PubChem CID 57066590) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is 2,10-dimethyl-10-azatricyclo[5.2.1.02,6]decane.
| Compound Name | 2,10-dimethyl-10-azatricyclo[5.2.1.02,6]decane |
|---|---|
| PubChem CID | 57066590 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 2,10-dimethyl-10-azatricyclo[5.2.1.02,6]decane |
| SMILES | CN1C2CCC1C1(C)CCCC21 |
| InChI | InChI=1S/C11H19N/c1-11-7-3-4-8(11)9-5-6-10(11)12(9)2/h8-10H,3-7H2,1-2H3 |
| InChIKey | DEPNOENPXUSXSG-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |