C9H18N2O — CID 22985119
5,5-dimethyl-3-(methylamino)azepan-2-one (PubChem CID 22985119) has the molecular formula C9H18N2O and a molecular weight of 170.26 g/mol. Its IUPAC name is 5,5-dimethyl-3-(methylamino)azepan-2-one.
| Compound Name | 5,5-dimethyl-3-(methylamino)azepan-2-one |
|---|---|
| PubChem CID | 22985119 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | 5,5-dimethyl-3-(methylamino)azepan-2-one |
| SMILES | CNC1CC(C)(C)CCNC1=O |
| InChI | InChI=1S/C9H18N2O/c1-9(2)4-5-11-8(12)7(6-9)10-3/h7,10H,4-6H2,1-3H3,(H,11,12) |
| InChIKey | GMSDHJDJNZIICB-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |