C14H26N2O — CID 124829255
(3S)-3-[[(1R,2R)-2,4,4-trimethylcyclopentyl]amino]azepan-2-one (PubChem CID 124829255) has the molecular formula C14H26N2O and a molecular weight of 238.37 g/mol. Its IUPAC name is (3S)-3-[[(1R,2R)-2,4,4-trimethylcyclopentyl]amino]azepan-2-one.
| Compound Name | (3S)-3-[[(1R,2R)-2,4,4-trimethylcyclopentyl]amino]azepan-2-one |
|---|---|
| PubChem CID | 124829255 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | (3S)-3-[[(1R,2R)-2,4,4-trimethylcyclopentyl]amino]azepan-2-one |
| SMILES | C[C@@H]1CC(C)(C)C[C@H]1N[C@H]1CCCCNC1=O |
| InChI | InChI=1S/C14H26N2O/c1-10-8-14(2,3)9-12(10)16-11-6-4-5-7-15-13(11)17/h10-12,16H,4-9H2,1-3H3,(H,15,17)/t10-,11+,12-/m1/s1 |
| InChIKey | BKHRNHPVSLCPIK-GRYCIOLGSA-N |
| XLogP | 2.07 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |