C8H12Cl2 — CID 95907784
(1S,4R)-2,2-dichloro-1-methylbicyclo[2.2.1]heptane (PubChem CID 95907784) has the molecular formula C8H12Cl2 and a molecular weight of 179.09 g/mol. Its IUPAC name is (1S,4R)-2,2-dichloro-1-methylbicyclo[2.2.1]heptane.
| Compound Name | (1S,4R)-2,2-dichloro-1-methylbicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 95907784 |
| Molecular Formula | C8H12Cl2 |
| Molecular Weight | 179.09 g/mol |
| Exact Mass | 178.03 |
| IUPAC Name | (1S,4R)-2,2-dichloro-1-methylbicyclo[2.2.1]heptane |
| SMILES | C[C@@]12CC[C@@H](CC1(Cl)Cl)C2 |
| InChI | InChI=1S/C8H12Cl2/c1-7-3-2-6(4-7)5-8(7,9)10/h6H,2-5H2,1H3/t6-,7+/m1/s1 |
| InChIKey | KEBQSKUALBYPQJ-RQJHMYQMSA-N |
| XLogP | 3.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.09 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|