C9H7F12N — CID 15468449
(2S,6R)-3,3,4,4,5,5-hexafluoro-2,6-dimethyl-2,6-bis(trifluoromethyl)piperidine (PubChem CID 15468449) has the molecular formula C9H7F12N and a molecular weight of 357.14 g/mol. Its IUPAC name is (2S,6R)-3,3,4,4,5,5-hexafluoro-2,6-dimethyl-2,6-bis(trifluoromethyl)piperidine.
| Compound Name | (2S,6R)-3,3,4,4,5,5-hexafluoro-2,6-dimethyl-2,6-bis(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 15468449 |
| Molecular Formula | C9H7F12N |
| Molecular Weight | 357.14 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | (2S,6R)-3,3,4,4,5,5-hexafluoro-2,6-dimethyl-2,6-bis(trifluoromethyl)piperidine |
| SMILES | C[C@@]1(C(F)(F)F)N[C@](C)(C(F)(F)F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C9H7F12N/c1-3(8(16,17)18)5(10,11)7(14,15)6(12,13)4(2,22-3)9(19,20)21/h22H,1-2H3/t3-,4+ |
| InChIKey | CXVQBZIFWSJGQL-ZXZARUISSA-N |
| XLogP | 4.14 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.14 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|