C12H13F10N — CID 18538151
2,2,3,3,4,4,5,5,6,6-decafluoro-1-(1-methylcyclohexyl)piperidine (PubChem CID 18538151) has the molecular formula C12H13F10N and a molecular weight of 361.22 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6-decafluoro-1-(1-methylcyclohexyl)piperidine.
| Compound Name | 2,2,3,3,4,4,5,5,6,6-decafluoro-1-(1-methylcyclohexyl)piperidine |
|---|---|
| PubChem CID | 18538151 |
| Molecular Formula | C12H13F10N |
| Molecular Weight | 361.22 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6-decafluoro-1-(1-methylcyclohexyl)piperidine |
| SMILES | CC1(N2C(F)(F)C(F)(F)C(F)(F)C(F)(F)C2(F)F)CCCCC1 |
| InChI | InChI=1S/C12H13F10N/c1-7(5-3-2-4-6-7)23-11(19,20)9(15,16)8(13,14)10(17,18)12(23,21)22/h2-6H2,1H3 |
| InChIKey | YQSJBOCQJFSTHL-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.22 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|