C12F23N — CID 142772647
1-[2,2,3,3,4,4,5,5,6,6-decafluoro-1-(trifluoromethyl)cyclohexyl]-2,2,3,3,4,4,5,5,6,6-decafluoropiperidine (PubChem CID 142772647) has the molecular formula C12F23N and a molecular weight of 595.09 g/mol. Its IUPAC name is 1-[2,2,3,3,4,4,5,5,6,6-decafluoro-1-(trifluoromethyl)cyclohexyl]-2,2,3,3,4,4,5,5,6,6-decafluoropiperidine.
| Compound Name | 1-[2,2,3,3,4,4,5,5,6,6-decafluoro-1-(trifluoromethyl)cyclohexyl]-2,2,3,3,4,4,5,5,6,6-decafluoropiperidine |
|---|---|
| PubChem CID | 142772647 |
| Molecular Formula | C12F23N |
| Molecular Weight | 595.09 g/mol |
| Exact Mass | 594.97 |
| IUPAC Name | 1-[2,2,3,3,4,4,5,5,6,6-decafluoro-1-(trifluoromethyl)cyclohexyl]-2,2,3,3,4,4,5,5,6,6-decafluoropiperidine |
| SMILES | FC(F)(F)C1(N2C(F)(F)C(F)(F)C(F)(F)C(F)(F)C2(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C12F23N/c13-2(14)1(10(29,30)31,3(15,16)5(19,20)6(21,22)4(2,17)18)36-11(32,33)8(25,26)7(23,24)9(27,28)12(36,34)35 |
| InChIKey | OMELVCQFDHGUAQ-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.09 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|