C14F29N — CID 139790263
1-[1,1,1,2,3,3,4,5,5,5-decafluoro-4-(trifluoromethyl)pentan-2-yl]-2,2,3,3,4,4,5,5,6-nonafluoro-6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)piperidine (PubChem CID 139790263) has the molecular formula C14F29N and a molecular weight of 733.10 g/mol. Its IUPAC name is 1-[1,1,1,2,3,3,4,5,5,5-decafluoro-4-(trifluoromethyl)pentan-2-yl]-2,2,3,3,4,4,5,5,6-nonafluoro-6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)piperidine.
| Compound Name | 1-[1,1,1,2,3,3,4,5,5,5-decafluoro-4-(trifluoromethyl)pentan-2-yl]-2,2,3,3,4,4,5,5,6-nonafluoro-6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)piperidine |
|---|---|
| PubChem CID | 139790263 |
| Molecular Formula | C14F29N |
| Molecular Weight | 733.10 g/mol |
| Exact Mass | 732.96 |
| IUPAC Name | 1-[1,1,1,2,3,3,4,5,5,5-decafluoro-4-(trifluoromethyl)pentan-2-yl]-2,2,3,3,4,4,5,5,6-nonafluoro-6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)piperidine |
| SMILES | FC(F)(F)C(F)(N1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14F29N/c15-1(9(27,28)29,10(30,31)32)3(17,18)8(26,13(39,40)41)44-7(25,2(16,11(33,34)35)12(36,37)38)5(21,22)4(19,20)6(23,24)14(44,42)43 |
| InChIKey | OJIQUIGQEDYLER-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.10 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|