C12F25N — CID 91154239
1-[1,1,2,2,3,3,4,5,5,6,6,6-dodecafluoro-4-(trifluoromethyl)hexyl]-2,2,3,3,4,4,5,5,6,6-decafluoropiperidine (PubChem CID 91154239) has the molecular formula C12F25N and a molecular weight of 633.09 g/mol. Its IUPAC name is 1-[1,1,2,2,3,3,4,5,5,6,6,6-dodecafluoro-4-(trifluoromethyl)hexyl]-2,2,3,3,4,4,5,5,6,6-decafluoropiperidine.
| Compound Name | 1-[1,1,2,2,3,3,4,5,5,6,6,6-dodecafluoro-4-(trifluoromethyl)hexyl]-2,2,3,3,4,4,5,5,6,6-decafluoropiperidine |
|---|---|
| PubChem CID | 91154239 |
| Molecular Formula | C12F25N |
| Molecular Weight | 633.09 g/mol |
| Exact Mass | 632.96 |
| IUPAC Name | 1-[1,1,2,2,3,3,4,5,5,6,6,6-dodecafluoro-4-(trifluoromethyl)hexyl]-2,2,3,3,4,4,5,5,6,6-decafluoropiperidine |
| SMILES | FC(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)N1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C12F25N/c13-1(8(26,27)28,3(16,17)9(29,30)31)2(14,15)5(20,21)10(32,33)38-11(34,35)6(22,23)4(18,19)7(24,25)12(38,36)37 |
| InChIKey | WZTJNKULHIODJA-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.09 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|