C13F25N — CID 10283000
1-[1,2,2,3,3,4,5,5,6,6-decafluoro-4-(trifluoromethyl)cyclohexyl]-2,2,3,3,4,5,5,6,6-nonafluoro-4-(trifluoromethyl)piperidine (PubChem CID 10283000) has the molecular formula C13F25N and a molecular weight of 645.10 g/mol. Its IUPAC name is 1-[1,2,2,3,3,4,5,5,6,6-decafluoro-4-(trifluoromethyl)cyclohexyl]-2,2,3,3,4,5,5,6,6-nonafluoro-4-(trifluoromethyl)piperidine.
| Compound Name | 1-[1,2,2,3,3,4,5,5,6,6-decafluoro-4-(trifluoromethyl)cyclohexyl]-2,2,3,3,4,5,5,6,6-nonafluoro-4-(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 10283000 |
| Molecular Formula | C13F25N |
| Molecular Weight | 645.10 g/mol |
| Exact Mass | 644.96 |
| IUPAC Name | 1-[1,2,2,3,3,4,5,5,6,6-decafluoro-4-(trifluoromethyl)cyclohexyl]-2,2,3,3,4,5,5,6,6-nonafluoro-4-(trifluoromethyl)piperidine |
| SMILES | FC(F)(F)C1(F)C(F)(F)C(F)(F)N(C2(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)C2(F)F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C13F25N/c14-1(10(29,30)31)3(16,17)7(24,25)9(28,8(26,27)4(1,18)19)39-12(35,36)5(20,21)2(15,11(32,33)34)6(22,23)13(39,37)38 |
| InChIKey | DKBZKTKZZHHJOZ-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.10 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|