C16H17NO4 — CID 177224111
methyl 1-oxo-2-(oxolan-2-ylmethyl)isoquinoline-4-carboxylate (PubChem CID 177224111) has the molecular formula C16H17NO4 and a molecular weight of 287.31 g/mol. Its IUPAC name is methyl 1-oxo-2-(oxolan-2-ylmethyl)isoquinoline-4-carboxylate.
| Compound Name | methyl 1-oxo-2-(oxolan-2-ylmethyl)isoquinoline-4-carboxylate |
|---|---|
| PubChem CID | 177224111 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | methyl 1-oxo-2-(oxolan-2-ylmethyl)isoquinoline-4-carboxylate |
| SMILES | COC(=O)c1cn(CC2CCCO2)c(=O)c2ccccc12 |
| InChI | InChI=1S/C16H17NO4/c1-20-16(19)14-10-17(9-11-5-4-8-21-11)15(18)13-7-3-2-6-12(13)14/h2-3,6-7,10-11H,4-5,8-9H2,1H3 |
| InChIKey | JRUHWPUNEKUODG-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |