About 1-chloropropyl N-hexylcarbamate
1-chloropropyl N-hexylcarbamate (PubChem CID 177224868) has the molecular formula C10H20ClNO2
and a molecular weight of 221.73 g/mol. Its IUPAC name is 1-chloropropyl N-hexylcarbamate.
Molecular Properties
| Compound Name | 1-chloropropyl N-hexylcarbamate |
| PubChem CID | 177224868 |
| Molecular Formula | C10H20ClNO2 |
| Molecular Weight | 221.73 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 1-chloropropyl N-hexylcarbamate |
| SMILES | CCCCCCNC(=O)OC(Cl)CC |
| InChI | InChI=1S/C10H20ClNO2/c1-3-5-6-7-8-12-10(13)14-9(11)4-2/h9H,3-8H2,1-2H3,(H,12,13) |
| InChIKey | SKCAWHWJNONTRW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.73 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloropropyl N-hexylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloropropyl N-hexylcarbamate?
The IUPAC name of 1-chloropropyl N-hexylcarbamate (CID 177224868) is 1-chloropropyl N-hexylcarbamate.
What is the SMILES notation for 1-chloropropyl N-hexylcarbamate?
The canonical SMILES for 1-chloropropyl N-hexylcarbamate is CCCCCCNC(=O)OC(Cl)CC.
What is the InChIKey of 1-chloropropyl N-hexylcarbamate?
The InChIKey is SKCAWHWJNONTRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20ClNO2/c1-3-5-6-7-8-12-10(13)14-9(11)4-2/h9H,3-8H2,1-2H3,(H,12,13).
What are the key properties of 1-chloropropyl N-hexylcarbamate?
1-chloropropyl N-hexylcarbamate has a molecular weight of 221.73 g/mol, XLogP of 3.27, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloropropyl N-hexylcarbamate is sourced from PubChem (CID 177224868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).